C12H20ClN3O — CID 114305784
N-(5-chloropentan-2-yl)-1,3,5-trimethylpyrazole-4-carboxamide (PubChem CID 114305784) has the molecular formula C12H20ClN3O and a molecular weight of 257.76 g/mol. Its IUPAC name is N-(5-chloropentan-2-yl)-1,3,5-trimethylpyrazole-4-carboxamide.
| Compound Name | N-(5-chloropentan-2-yl)-1,3,5-trimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 114305784 |
| Molecular Formula | C12H20ClN3O |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | N-(5-chloropentan-2-yl)-1,3,5-trimethylpyrazole-4-carboxamide |
| SMILES | Cc1nn(C)c(C)c1C(=O)NC(C)CCCCl |
| InChI | InChI=1S/C12H20ClN3O/c1-8(6-5-7-13)14-12(17)11-9(2)15-16(4)10(11)3/h8H,5-7H2,1-4H3,(H,14,17) |
| InChIKey | NLRDCCZHDZZGQS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|