C14H24ClN3O — CID 106117786
N-[2-(2-chloroethyl)pentyl]-1,3,5-trimethylpyrazole-4-carboxamide (PubChem CID 106117786) has the molecular formula C14H24ClN3O and a molecular weight of 285.82 g/mol. Its IUPAC name is N-[2-(2-chloroethyl)pentyl]-1,3,5-trimethylpyrazole-4-carboxamide.
| Compound Name | N-[2-(2-chloroethyl)pentyl]-1,3,5-trimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 106117786 |
| Molecular Formula | C14H24ClN3O |
| Molecular Weight | 285.82 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | N-[2-(2-chloroethyl)pentyl]-1,3,5-trimethylpyrazole-4-carboxamide |
| SMILES | CCCC(CCCl)CNC(=O)c1c(C)nn(C)c1C |
| InChI | InChI=1S/C14H24ClN3O/c1-5-6-12(7-8-15)9-16-14(19)13-10(2)17-18(4)11(13)3/h12H,5-9H2,1-4H3,(H,16,19) |
| InChIKey | SQFWUWQJIRBFAI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.82 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|