C14H17BrClF2NO — CID 106117750
4-bromo-N-[2-(2-chloroethyl)pentyl]-2,6-difluorobenzamide (PubChem CID 106117750) has the molecular formula C14H17BrClF2NO and a molecular weight of 368.65 g/mol. Its IUPAC name is 4-bromo-N-[2-(2-chloroethyl)pentyl]-2,6-difluorobenzamide.
| Compound Name | 4-bromo-N-[2-(2-chloroethyl)pentyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 106117750 |
| Molecular Formula | C14H17BrClF2NO |
| Molecular Weight | 368.65 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | 4-bromo-N-[2-(2-chloroethyl)pentyl]-2,6-difluorobenzamide |
| SMILES | CCCC(CCCl)CNC(=O)c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C14H17BrClF2NO/c1-2-3-9(4-5-16)8-19-14(20)13-11(17)6-10(15)7-12(13)18/h6-7,9H,2-5,8H2,1H3,(H,19,20) |
| InChIKey | HSZPKIVMQHVJKQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.65 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|