C14H18Br3NO — CID 114145772
3,5-dibromo-N-[2-(2-bromoethyl)pentyl]benzamide (PubChem CID 114145772) has the molecular formula C14H18Br3NO and a molecular weight of 456.02 g/mol. Its IUPAC name is 3,5-dibromo-N-[2-(2-bromoethyl)pentyl]benzamide.
| Compound Name | 3,5-dibromo-N-[2-(2-bromoethyl)pentyl]benzamide |
|---|---|
| PubChem CID | 114145772 |
| Molecular Formula | C14H18Br3NO |
| Molecular Weight | 456.02 g/mol |
| Exact Mass | 452.89 |
| IUPAC Name | 3,5-dibromo-N-[2-(2-bromoethyl)pentyl]benzamide |
| SMILES | CCCC(CCBr)CNC(=O)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C14H18Br3NO/c1-2-3-10(4-5-15)9-18-14(19)11-6-12(16)8-13(17)7-11/h6-8,10H,2-5,9H2,1H3,(H,18,19) |
| InChIKey | HAIIAAMOWYWAGA-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.02 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|