C10H17BrN4O — CID 106118031
N-[2-(2-bromoethyl)pentyl]-2H-triazole-4-carboxamide (PubChem CID 106118031) has the molecular formula C10H17BrN4O and a molecular weight of 289.18 g/mol. Its IUPAC name is N-[2-(2-bromoethyl)pentyl]-2H-triazole-4-carboxamide.
| Compound Name | N-[2-(2-bromoethyl)pentyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 106118031 |
| Molecular Formula | C10H17BrN4O |
| Molecular Weight | 289.18 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | N-[2-(2-bromoethyl)pentyl]-2H-triazole-4-carboxamide |
| SMILES | CCCC(CCBr)CNC(=O)c1cn[nH]n1 |
| InChI | InChI=1S/C10H17BrN4O/c1-2-3-8(4-5-11)6-12-10(16)9-7-13-15-14-9/h7-8H,2-6H2,1H3,(H,12,16)(H,13,14,15) |
| InChIKey | DPPXXBWQNAHGJF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.18 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|