C14H19BrFNO2 — CID 106117986
N-[2-(2-bromoethyl)pentyl]-2-fluoro-6-hydroxybenzamide (PubChem CID 106117986) has the molecular formula C14H19BrFNO2 and a molecular weight of 332.21 g/mol. Its IUPAC name is N-[2-(2-bromoethyl)pentyl]-2-fluoro-6-hydroxybenzamide.
| Compound Name | N-[2-(2-bromoethyl)pentyl]-2-fluoro-6-hydroxybenzamide |
|---|---|
| PubChem CID | 106117986 |
| Molecular Formula | C14H19BrFNO2 |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | N-[2-(2-bromoethyl)pentyl]-2-fluoro-6-hydroxybenzamide |
| SMILES | CCCC(CCBr)CNC(=O)c1c(O)cccc1F |
| InChI | InChI=1S/C14H19BrFNO2/c1-2-4-10(7-8-15)9-17-14(19)13-11(16)5-3-6-12(13)18/h3,5-6,10,18H,2,4,7-9H2,1H3,(H,17,19) |
| InChIKey | KOYWPKINIPTAEO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|