C11H18BrN3O2 — CID 114309337
N-[2-(2-bromoethoxy)ethyl]-1,3,5-trimethylpyrazole-4-carboxamide (PubChem CID 114309337) has the molecular formula C11H18BrN3O2 and a molecular weight of 304.19 g/mol. Its IUPAC name is N-[2-(2-bromoethoxy)ethyl]-1,3,5-trimethylpyrazole-4-carboxamide.
| Compound Name | N-[2-(2-bromoethoxy)ethyl]-1,3,5-trimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 114309337 |
| Molecular Formula | C11H18BrN3O2 |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | N-[2-(2-bromoethoxy)ethyl]-1,3,5-trimethylpyrazole-4-carboxamide |
| SMILES | Cc1nn(C)c(C)c1C(=O)NCCOCCBr |
| InChI | InChI=1S/C11H18BrN3O2/c1-8-10(9(2)15(3)14-8)11(16)13-5-7-17-6-4-12/h4-7H2,1-3H3,(H,13,16) |
| InChIKey | HAHKBFDKAZWIOL-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|