C12H20N2O — CID 105091756
3-methyl-1-(1,3,5-trimethylpyrazol-4-yl)pentan-1-one (PubChem CID 105091756) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 3-methyl-1-(1,3,5-trimethylpyrazol-4-yl)pentan-1-one.
| Compound Name | 3-methyl-1-(1,3,5-trimethylpyrazol-4-yl)pentan-1-one |
|---|---|
| PubChem CID | 105091756 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 3-methyl-1-(1,3,5-trimethylpyrazol-4-yl)pentan-1-one |
| SMILES | CCC(C)CC(=O)c1c(C)nn(C)c1C |
| InChI | InChI=1S/C12H20N2O/c1-6-8(2)7-11(15)12-9(3)13-14(5)10(12)4/h8H,6-7H2,1-5H3 |
| InChIKey | SNWQBQZKJMQYKO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |