C23H34F5NO5 — CID 157104676
(2,3,4,5,6-pentafluorophenyl) N-[2-(diethoxymethoxy)undecyl]carbamate (PubChem CID 157104676) has the molecular formula C23H34F5NO5 and a molecular weight of 499.52 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) N-[2-(diethoxymethoxy)undecyl]carbamate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) N-[2-(diethoxymethoxy)undecyl]carbamate |
|---|---|
| PubChem CID | 157104676 |
| Molecular Formula | C23H34F5NO5 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) N-[2-(diethoxymethoxy)undecyl]carbamate |
| SMILES | CCCCCCCCCC(CNC(=O)Oc1c(F)c(F)c(F)c(F)c1F)OC(OCC)OCC |
| InChI | InChI=1S/C23H34F5NO5/c1-4-7-8-9-10-11-12-13-15(33-23(31-5-2)32-6-3)14-29-22(30)34-21-19(27)17(25)16(24)18(26)20(21)28/h15,23H,4-14H2,1-3H3,(H,29,30) |
| InChIKey | HLQWQHQXMKAMNK-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|