C22H36F2O3 — CID 151723088
1-[2-(diethoxymethoxy)undecyl]-3,5-difluorobenzene (PubChem CID 151723088) has the molecular formula C22H36F2O3 and a molecular weight of 386.52 g/mol. Its IUPAC name is 1-[2-(diethoxymethoxy)undecyl]-3,5-difluorobenzene.
| Compound Name | 1-[2-(diethoxymethoxy)undecyl]-3,5-difluorobenzene |
|---|---|
| PubChem CID | 151723088 |
| Molecular Formula | C22H36F2O3 |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.26 |
| IUPAC Name | 1-[2-(diethoxymethoxy)undecyl]-3,5-difluorobenzene |
| SMILES | CCCCCCCCCC(Cc1cc(F)cc(F)c1)OC(OCC)OCC |
| InChI | InChI=1S/C22H36F2O3/c1-4-7-8-9-10-11-12-13-21(27-22(25-5-2)26-6-3)16-18-14-19(23)17-20(24)15-18/h14-15,17,21-22H,4-13,16H2,1-3H3 |
| InChIKey | RIZPMNVRFLDKDV-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|