C12H18F2O3Si — CID 154058701
diethoxymethoxy-[(3,5-difluorophenyl)methyl]silane (PubChem CID 154058701) has the molecular formula C12H18F2O3Si and a molecular weight of 276.36 g/mol. Its IUPAC name is diethoxymethoxy-[(3,5-difluorophenyl)methyl]silane.
| Compound Name | diethoxymethoxy-[(3,5-difluorophenyl)methyl]silane |
|---|---|
| PubChem CID | 154058701 |
| Molecular Formula | C12H18F2O3Si |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | diethoxymethoxy-[(3,5-difluorophenyl)methyl]silane |
| SMILES | CCOC(OCC)O[SiH2]Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H18F2O3Si/c1-3-15-12(16-4-2)17-18-8-9-5-10(13)7-11(14)6-9/h5-7,12H,3-4,8,18H2,1-2H3 |
| InChIKey | HXRMVXPXDLIBSR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|