C16H26F2O3Si — CID 154500811
3-(3,5-difluorophenyl)propyl-[di(propan-2-yloxy)methoxy]silane (PubChem CID 154500811) has the molecular formula C16H26F2O3Si and a molecular weight of 332.46 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)propyl-[di(propan-2-yloxy)methoxy]silane.
| Compound Name | 3-(3,5-difluorophenyl)propyl-[di(propan-2-yloxy)methoxy]silane |
|---|---|
| PubChem CID | 154500811 |
| Molecular Formula | C16H26F2O3Si |
| Molecular Weight | 332.46 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 3-(3,5-difluorophenyl)propyl-[di(propan-2-yloxy)methoxy]silane |
| SMILES | CC(C)OC(O[SiH2]CCCc1cc(F)cc(F)c1)OC(C)C |
| InChI | InChI=1S/C16H26F2O3Si/c1-11(2)19-16(20-12(3)4)21-22-7-5-6-13-8-14(17)10-15(18)9-13/h8-12,16H,5-7,22H2,1-4H3 |
| InChIKey | UKAWGPAKJIVPJV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|