C27H34F8N4O5Si — CID 59172546
2,3,5,6-tetrafluoro-4-[5-[2,3,5,6-tetrafluoro-4-(2-trimethoxysilylethylcarbamoyl)anilino]octan-4-ylamino]benzamide (PubChem CID 59172546) has the molecular formula C27H34F8N4O5Si and a molecular weight of 674.66 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[5-[2,3,5,6-tetrafluoro-4-(2-trimethoxysilylethylcarbamoyl)anilino]octan-4-ylamino]benzamide.
| Compound Name | 2,3,5,6-tetrafluoro-4-[5-[2,3,5,6-tetrafluoro-4-(2-trimethoxysilylethylcarbamoyl)anilino]octan-4-ylamino]benzamide |
|---|---|
| PubChem CID | 59172546 |
| Molecular Formula | C27H34F8N4O5Si |
| Molecular Weight | 674.66 g/mol |
| Exact Mass | 674.22 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[5-[2,3,5,6-tetrafluoro-4-(2-trimethoxysilylethylcarbamoyl)anilino]octan-4-ylamino]benzamide |
| SMILES | CCCC(Nc1c(F)c(F)c(C(N)=O)c(F)c1F)C(CCC)Nc1c(F)c(F)c(C(=O)NCC[Si](OC)(OC)OC)c(F)c1F |
| InChI | InChI=1S/C27H34F8N4O5Si/c1-6-8-12(38-24-20(32)16(28)14(26(36)40)17(29)21(24)33)13(9-7-2)39-25-22(34)18(30)15(19(31)23(25)35)27(41)37-10-11-45(42-3,43-4)44-5/h12-13,38-39H,6-11H2,1-5H3,(H2,36,40)(H,37,41) |
| InChIKey | RKOFKCULJBGEGU-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 123.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.66 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|