C26H41F5O3 — CID 172747189
1,2,3,4,5-pentafluoro-6-[2-methyl-4-(triethoxymethyl)dodecyl]benzene (PubChem CID 172747189) has the molecular formula C26H41F5O3 and a molecular weight of 496.60 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[2-methyl-4-(triethoxymethyl)dodecyl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[2-methyl-4-(triethoxymethyl)dodecyl]benzene |
|---|---|
| PubChem CID | 172747189 |
| Molecular Formula | C26H41F5O3 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.30 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[2-methyl-4-(triethoxymethyl)dodecyl]benzene |
| SMILES | CCCCCCCCC(CC(C)Cc1c(F)c(F)c(F)c(F)c1F)C(OCC)(OCC)OCC |
| InChI | InChI=1S/C26H41F5O3/c1-6-10-11-12-13-14-15-19(26(32-7-2,33-8-3)34-9-4)16-18(5)17-20-21(27)23(29)25(31)24(30)22(20)28/h18-19H,6-17H2,1-5H3 |
| InChIKey | JWPUZIKGEICEGP-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|