C28H45F5O3 — CID 150407829
1,2,3,4,5-pentafluoro-6-[4-[tri(propan-2-yloxy)methyl]dodecan-2-yl]benzene (PubChem CID 150407829) has the molecular formula C28H45F5O3 and a molecular weight of 524.66 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[4-[tri(propan-2-yloxy)methyl]dodecan-2-yl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[4-[tri(propan-2-yloxy)methyl]dodecan-2-yl]benzene |
|---|---|
| PubChem CID | 150407829 |
| Molecular Formula | C28H45F5O3 |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.33 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[4-[tri(propan-2-yloxy)methyl]dodecan-2-yl]benzene |
| SMILES | CCCCCCCCC(CC(C)c1c(F)c(F)c(F)c(F)c1F)C(OC(C)C)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C28H45F5O3/c1-9-10-11-12-13-14-15-21(28(34-17(2)3,35-18(4)5)36-19(6)7)16-20(8)22-23(29)25(31)27(33)26(32)24(22)30/h17-21H,9-16H2,1-8H3 |
| InChIKey | HFDKXLKDXUPQJF-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|