C13H15F5O — CID 115783388
1-(2,3,4,5,6-pentafluorophenyl)heptan-1-ol (PubChem CID 115783388) has the molecular formula C13H15F5O and a molecular weight of 282.25 g/mol. Its IUPAC name is 1-(2,3,4,5,6-pentafluorophenyl)heptan-1-ol.
| Compound Name | 1-(2,3,4,5,6-pentafluorophenyl)heptan-1-ol |
|---|---|
| PubChem CID | 115783388 |
| Molecular Formula | C13H15F5O |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 1-(2,3,4,5,6-pentafluorophenyl)heptan-1-ol |
| SMILES | CCCCCCC(O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H15F5O/c1-2-3-4-5-6-7(19)8-9(14)11(16)13(18)12(17)10(8)15/h7,19H,2-6H2,1H3 |
| InChIKey | JPVUPGWUMJQAJM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|