C21H44O3 — CID 157221541
2,2-diethoxy-3-(2-methoxyethyl)undecane;prop-1-ene (PubChem CID 157221541) has the molecular formula C21H44O3 and a molecular weight of 344.58 g/mol. Its IUPAC name is 2,2-diethoxy-3-(2-methoxyethyl)undecane;prop-1-ene.
| Compound Name | 2,2-diethoxy-3-(2-methoxyethyl)undecane;prop-1-ene |
|---|---|
| PubChem CID | 157221541 |
| Molecular Formula | C21H44O3 |
| Molecular Weight | 344.58 g/mol |
| Exact Mass | 344.33 |
| IUPAC Name | 2,2-diethoxy-3-(2-methoxyethyl)undecane;prop-1-ene |
| SMILES | C=CC.CCCCCCCCC(CCOC)C(C)(OCC)OCC |
| InChI | InChI=1S/C18H38O3.C3H6/c1-6-9-10-11-12-13-14-17(15-16-19-5)18(4,20-7-2)21-8-3;1-3-2/h17H,6-16H2,1-5H3;3H,1H2,2H3 |
| InChIKey | ATAZUSJFUWYDOX-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.58 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|