C24H50O3 — CID 158251211
3,3-dibutoxy-4-(3-methoxypropyl)dodecane (PubChem CID 158251211) has the molecular formula C24H50O3 and a molecular weight of 386.66 g/mol. Its IUPAC name is 3,3-dibutoxy-4-(3-methoxypropyl)dodecane.
| Compound Name | 3,3-dibutoxy-4-(3-methoxypropyl)dodecane |
|---|---|
| PubChem CID | 158251211 |
| Molecular Formula | C24H50O3 |
| Molecular Weight | 386.66 g/mol |
| Exact Mass | 386.38 |
| IUPAC Name | 3,3-dibutoxy-4-(3-methoxypropyl)dodecane |
| SMILES | CCCCCCCCC(CCCOC)C(CC)(OCCCC)OCCCC |
| InChI | InChI=1S/C24H50O3/c1-6-10-13-14-15-16-18-23(19-17-20-25-5)24(9-4,26-21-11-7-2)27-22-12-8-3/h23H,6-22H2,1-5H3 |
| InChIKey | BYUXFYHTRJRHLM-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.66 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|