C21H44O4 — CID 151863987
3,3-bis(2-methoxyethoxy)-4-propyldodecane (PubChem CID 151863987) has the molecular formula C21H44O4 and a molecular weight of 360.58 g/mol. Its IUPAC name is 3,3-bis(2-methoxyethoxy)-4-propyldodecane.
| Compound Name | 3,3-bis(2-methoxyethoxy)-4-propyldodecane |
|---|---|
| PubChem CID | 151863987 |
| Molecular Formula | C21H44O4 |
| Molecular Weight | 360.58 g/mol |
| Exact Mass | 360.32 |
| IUPAC Name | 3,3-bis(2-methoxyethoxy)-4-propyldodecane |
| SMILES | CCCCCCCCC(CCC)C(CC)(OCCOC)OCCOC |
| InChI | InChI=1S/C21H44O4/c1-6-9-10-11-12-13-15-20(14-7-2)21(8-3,24-18-16-22-4)25-19-17-23-5/h20H,6-19H2,1-5H3 |
| InChIKey | SLHBPXQEOHVGPM-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.58 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|