C18H38O2 — CID 151317508
4,4-dimethoxy-5-propyltridecane (PubChem CID 151317508) has the molecular formula C18H38O2 and a molecular weight of 286.50 g/mol. Its IUPAC name is 4,4-dimethoxy-5-propyltridecane.
| Compound Name | 4,4-dimethoxy-5-propyltridecane |
|---|---|
| PubChem CID | 151317508 |
| Molecular Formula | C18H38O2 |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.29 |
| IUPAC Name | 4,4-dimethoxy-5-propyltridecane |
| SMILES | CCCCCCCCC(CCC)C(CCC)(OC)OC |
| InChI | InChI=1S/C18H38O2/c1-6-9-10-11-12-13-15-17(14-7-2)18(19-4,20-5)16-8-3/h17H,6-16H2,1-5H3 |
| InChIKey | OFTCDOQQZMYUJW-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|