C17H36O2 — CID 150194841
5,5-dimethoxy-6-methyltetradecane (PubChem CID 150194841) has the molecular formula C17H36O2 and a molecular weight of 272.47 g/mol. Its IUPAC name is 5,5-dimethoxy-6-methyltetradecane.
| Compound Name | 5,5-dimethoxy-6-methyltetradecane |
|---|---|
| PubChem CID | 150194841 |
| Molecular Formula | C17H36O2 |
| Molecular Weight | 272.47 g/mol |
| Exact Mass | 272.27 |
| IUPAC Name | 5,5-dimethoxy-6-methyltetradecane |
| SMILES | CCCCCCCCC(C)C(CCCC)(OC)OC |
| InChI | InChI=1S/C17H36O2/c1-6-8-10-11-12-13-14-16(3)17(18-4,19-5)15-9-7-2/h16H,6-15H2,1-5H3 |
| InChIKey | FOFLUZFFOQZMNU-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.47 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|