C18H38O2 — CID 150600164
4-(1,1-dimethoxyethyl)-3,3-dimethyldodecane (PubChem CID 150600164) has the molecular formula C18H38O2 and a molecular weight of 286.50 g/mol. Its IUPAC name is 4-(1,1-dimethoxyethyl)-3,3-dimethyldodecane.
| Compound Name | 4-(1,1-dimethoxyethyl)-3,3-dimethyldodecane |
|---|---|
| PubChem CID | 150600164 |
| Molecular Formula | C18H38O2 |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.29 |
| IUPAC Name | 4-(1,1-dimethoxyethyl)-3,3-dimethyldodecane |
| SMILES | CCCCCCCCC(C(C)(C)CC)C(C)(OC)OC |
| InChI | InChI=1S/C18H38O2/c1-8-10-11-12-13-14-15-16(17(3,4)9-2)18(5,19-6)20-7/h16H,8-15H2,1-7H3 |
| InChIKey | IRRXXRGOLVWCEH-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|