C20H42O2 — CID 152688982
4-tert-butyl-3,3-dimethoxy-2,2-dimethyldodecane (PubChem CID 152688982) has the molecular formula C20H42O2 and a molecular weight of 314.55 g/mol. Its IUPAC name is 4-tert-butyl-3,3-dimethoxy-2,2-dimethyldodecane.
| Compound Name | 4-tert-butyl-3,3-dimethoxy-2,2-dimethyldodecane |
|---|---|
| PubChem CID | 152688982 |
| Molecular Formula | C20H42O2 |
| Molecular Weight | 314.55 g/mol |
| Exact Mass | 314.32 |
| IUPAC Name | 4-tert-butyl-3,3-dimethoxy-2,2-dimethyldodecane |
| SMILES | CCCCCCCCC(C(C)(C)C)C(OC)(OC)C(C)(C)C |
| InChI | InChI=1S/C20H42O2/c1-10-11-12-13-14-15-16-17(18(2,3)4)20(21-8,22-9)19(5,6)7/h17H,10-16H2,1-9H3 |
| InChIKey | ZPEFNJUZEBNPPZ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.55 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|