C24H46O — CID 152731804
2,2-dimethyl-3-(2-oct-1-yn-3-yloxypropan-2-yl)undecane (PubChem CID 152731804) has the molecular formula C24H46O and a molecular weight of 350.63 g/mol. Its IUPAC name is 2,2-dimethyl-3-(2-oct-1-yn-3-yloxypropan-2-yl)undecane.
| Compound Name | 2,2-dimethyl-3-(2-oct-1-yn-3-yloxypropan-2-yl)undecane |
|---|---|
| PubChem CID | 152731804 |
| Molecular Formula | C24H46O |
| Molecular Weight | 350.63 g/mol |
| Exact Mass | 350.35 |
| IUPAC Name | 2,2-dimethyl-3-(2-oct-1-yn-3-yloxypropan-2-yl)undecane |
| SMILES | C#CC(CCCCC)OC(C)(C)C(CCCCCCCC)C(C)(C)C |
| InChI | InChI=1S/C24H46O/c1-9-12-14-15-16-18-20-22(23(4,5)6)24(7,8)25-21(11-3)19-17-13-10-2/h3,21-22H,9-10,12-20H2,1-2,4-8H3 |
| InChIKey | ZXTZTJWPAHIERY-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.63 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|