C23H49O2P — CID 152691310
4-(1,1-diethoxypropyl)dodecyl-diethylphosphane (PubChem CID 152691310) has the molecular formula C23H49O2P and a molecular weight of 388.62 g/mol. Its IUPAC name is 4-(1,1-diethoxypropyl)dodecyl-diethylphosphane.
| Compound Name | 4-(1,1-diethoxypropyl)dodecyl-diethylphosphane |
|---|---|
| PubChem CID | 152691310 |
| Molecular Formula | C23H49O2P |
| Molecular Weight | 388.62 g/mol |
| Exact Mass | 388.35 |
| IUPAC Name | 4-(1,1-diethoxypropyl)dodecyl-diethylphosphane |
| SMILES | CCCCCCCCC(CCCP(CC)CC)C(CC)(OCC)OCC |
| InChI | InChI=1S/C23H49O2P/c1-7-13-14-15-16-17-19-22(20-18-21-26(11-5)12-6)23(8-2,24-9-3)25-10-4/h22H,7-21H2,1-6H3 |
| InChIKey | ZPPVWNODGPZQCT-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.62 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|