C20H42O2S — CID 150466211
3-[1,1-di(propan-2-yloxy)propyl]undecane-1-thiol (PubChem CID 150466211) has the molecular formula C20H42O2S and a molecular weight of 346.62 g/mol. Its IUPAC name is 3-[1,1-di(propan-2-yloxy)propyl]undecane-1-thiol.
| Compound Name | 3-[1,1-di(propan-2-yloxy)propyl]undecane-1-thiol |
|---|---|
| PubChem CID | 150466211 |
| Molecular Formula | C20H42O2S |
| Molecular Weight | 346.62 g/mol |
| Exact Mass | 346.29 |
| IUPAC Name | 3-[1,1-di(propan-2-yloxy)propyl]undecane-1-thiol |
| SMILES | CCCCCCCCC(CCS)C(CC)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C20H42O2S/c1-7-9-10-11-12-13-14-19(15-16-23)20(8-2,21-17(3)4)22-18(5)6/h17-19,23H,7-16H2,1-6H3 |
| InChIKey | HQVHYMSIHHRIOI-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.62 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|