C19H38O3 — CID 150210042
2,2-dimethoxy-3-[2-(2-methylprop-1-enoxy)ethyl]undecane (PubChem CID 150210042) has the molecular formula C19H38O3 and a molecular weight of 314.51 g/mol. Its IUPAC name is 2,2-dimethoxy-3-[2-(2-methylprop-1-enoxy)ethyl]undecane.
| Compound Name | 2,2-dimethoxy-3-[2-(2-methylprop-1-enoxy)ethyl]undecane |
|---|---|
| PubChem CID | 150210042 |
| Molecular Formula | C19H38O3 |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.28 |
| IUPAC Name | 2,2-dimethoxy-3-[2-(2-methylprop-1-enoxy)ethyl]undecane |
| SMILES | CCCCCCCCC(CCOC=C(C)C)C(C)(OC)OC |
| InChI | InChI=1S/C19H38O3/c1-7-8-9-10-11-12-13-18(19(4,20-5)21-6)14-15-22-16-17(2)3/h16,18H,7-15H2,1-6H3 |
| InChIKey | FRHGHMHZFBDHNE-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|