C17H34O3 — CID 152701590
3-[2-(1,1-dimethoxyethyl)decyl]oxetane (PubChem CID 152701590) has the molecular formula C17H34O3 and a molecular weight of 286.46 g/mol. Its IUPAC name is 3-[2-(1,1-dimethoxyethyl)decyl]oxetane.
| Compound Name | 3-[2-(1,1-dimethoxyethyl)decyl]oxetane |
|---|---|
| PubChem CID | 152701590 |
| Molecular Formula | C17H34O3 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.25 |
| IUPAC Name | 3-[2-(1,1-dimethoxyethyl)decyl]oxetane |
| SMILES | CCCCCCCCC(CC1COC1)C(C)(OC)OC |
| InChI | InChI=1S/C17H34O3/c1-5-6-7-8-9-10-11-16(12-15-13-20-14-15)17(2,18-3)19-4/h15-16H,5-14H2,1-4H3 |
| InChIKey | ZRRQUJWJXPININ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|