C21H40O3 — CID 150483241
3-[3-(1,1-dimethoxyethyl)undecyl]-7-oxabicyclo[4.1.0]heptane (PubChem CID 150483241) has the molecular formula C21H40O3 and a molecular weight of 340.55 g/mol. Its IUPAC name is 3-[3-(1,1-dimethoxyethyl)undecyl]-7-oxabicyclo[4.1.0]heptane.
| Compound Name | 3-[3-(1,1-dimethoxyethyl)undecyl]-7-oxabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 150483241 |
| Molecular Formula | C21H40O3 |
| Molecular Weight | 340.55 g/mol |
| Exact Mass | 340.30 |
| IUPAC Name | 3-[3-(1,1-dimethoxyethyl)undecyl]-7-oxabicyclo[4.1.0]heptane |
| SMILES | CCCCCCCCC(CCC1CCC2OC2C1)C(C)(OC)OC |
| InChI | InChI=1S/C21H40O3/c1-5-6-7-8-9-10-11-18(21(2,22-3)23-4)14-12-17-13-15-19-20(16-17)24-19/h17-20H,5-16H2,1-4H3 |
| InChIKey | HUGSGRLPJVVYCV-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.55 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|