C18H31F7O3 — CID 150818115
1,1,1,2,2,3,3-heptafluoro-6-(trimethoxymethyl)tetradecane (PubChem CID 150818115) has the molecular formula C18H31F7O3 and a molecular weight of 428.43 g/mol. Its IUPAC name is 1,1,1,2,2,3,3-heptafluoro-6-(trimethoxymethyl)tetradecane.
| Compound Name | 1,1,1,2,2,3,3-heptafluoro-6-(trimethoxymethyl)tetradecane |
|---|---|
| PubChem CID | 150818115 |
| Molecular Formula | C18H31F7O3 |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 1,1,1,2,2,3,3-heptafluoro-6-(trimethoxymethyl)tetradecane |
| SMILES | CCCCCCCCC(CCC(F)(F)C(F)(F)C(F)(F)F)C(OC)(OC)OC |
| InChI | InChI=1S/C18H31F7O3/c1-5-6-7-8-9-10-11-14(16(26-2,27-3)28-4)12-13-15(19,20)17(21,22)18(23,24)25/h14H,5-13H2,1-4H3 |
| InChIKey | KJIGGGYMHXGJPW-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|