C20H29F13O3 — CID 150320686
1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-9-(trimethoxymethyl)hexadecane (PubChem CID 150320686) has the molecular formula C20H29F13O3 and a molecular weight of 564.42 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-9-(trimethoxymethyl)hexadecane.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-9-(trimethoxymethyl)hexadecane |
|---|---|
| PubChem CID | 150320686 |
| Molecular Formula | C20H29F13O3 |
| Molecular Weight | 564.42 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-9-(trimethoxymethyl)hexadecane |
| SMILES | CCCCCCCC(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(OC)(OC)OC |
| InChI | InChI=1S/C20H29F13O3/c1-5-6-7-8-9-10-13(15(34-2,35-3)36-4)11-12-14(21,22)16(23,24)17(25,26)18(27,28)19(29,30)20(31,32)33/h13H,5-12H2,1-4H3 |
| InChIKey | GNOLVVYQRCVTAT-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.42 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|