C19H27F15OSn — CID 87372400
heptoxy-tris(1,1,2,2,3-pentafluorobutyl)stannane (PubChem CID 87372400) has the molecular formula C19H27F15OSn and a molecular weight of 675.10 g/mol. Its IUPAC name is heptoxy-tris(1,1,2,2,3-pentafluorobutyl)stannane.
| Compound Name | heptoxy-tris(1,1,2,2,3-pentafluorobutyl)stannane |
|---|---|
| PubChem CID | 87372400 |
| Molecular Formula | C19H27F15OSn |
| Molecular Weight | 675.10 g/mol |
| Exact Mass | 676.08 |
| IUPAC Name | heptoxy-tris(1,1,2,2,3-pentafluorobutyl)stannane |
| SMILES | CCCCCCCO[Sn](C(F)(F)C(F)(F)C(C)F)(C(F)(F)C(F)(F)C(C)F)C(F)(F)C(F)(F)C(C)F |
| InChI | InChI=1S/C7H15O.3C4H4F5.Sn/c1-2-3-4-5-6-7-8;3*1-2(5)4(8,9)3(6)7;/h2-7H2,1H3;3*2H,1H3;/q-1;;;;+1 |
| InChIKey | FBNOYUZLGBHTLO-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.10 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|