C22H38F10O2Sn — CID 87370851
diheptoxy-bis(1,2,3,4,4-pentafluorobutyl)stannane (PubChem CID 87370851) has the molecular formula C22H38F10O2Sn and a molecular weight of 643.23 g/mol. Its IUPAC name is diheptoxy-bis(1,2,3,4,4-pentafluorobutyl)stannane.
| Compound Name | diheptoxy-bis(1,2,3,4,4-pentafluorobutyl)stannane |
|---|---|
| PubChem CID | 87370851 |
| Molecular Formula | C22H38F10O2Sn |
| Molecular Weight | 643.23 g/mol |
| Exact Mass | 644.17 |
| IUPAC Name | diheptoxy-bis(1,2,3,4,4-pentafluorobutyl)stannane |
| SMILES | CCCCCCCO[Sn](OCCCCCCC)(C(F)C(F)C(F)C(F)F)C(F)C(F)C(F)C(F)F |
| InChI | InChI=1S/2C7H15O.2C4H4F5.Sn/c2*1-2-3-4-5-6-7-8;2*5-1-2(6)3(7)4(8)9;/h2*2-7H2,1H3;2*1-4H;/q2*-1;;;+2 |
| InChIKey | HTHRXBPBPBCSMB-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.23 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|