C10H19F3O2 — CID 19905073
1,2,4-trifluoro-3-hexoxybutan-1-ol (PubChem CID 19905073) has the molecular formula C10H19F3O2 and a molecular weight of 228.25 g/mol. Its IUPAC name is 1,2,4-trifluoro-3-hexoxybutan-1-ol.
| Compound Name | 1,2,4-trifluoro-3-hexoxybutan-1-ol |
|---|---|
| PubChem CID | 19905073 |
| Molecular Formula | C10H19F3O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 1,2,4-trifluoro-3-hexoxybutan-1-ol |
| SMILES | CCCCCCOC(CF)C(F)C(O)F |
| InChI | InChI=1S/C10H19F3O2/c1-2-3-4-5-6-15-8(7-11)9(12)10(13)14/h8-10,14H,2-7H2,1H3 |
| InChIKey | AHIFDBZCCICHCM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|