About 1-pentan-3-yloxydecane
1-pentan-3-yloxydecane (PubChem CID 173279604) has the molecular formula C15H32O
and a molecular weight of 228.42 g/mol. Its IUPAC name is 1-pentan-3-yloxydecane.
Molecular Properties
| Compound Name | 1-pentan-3-yloxydecane |
| PubChem CID | 173279604 |
| Molecular Formula | C15H32O |
| Molecular Weight | 228.42 g/mol |
| Exact Mass | 228.25 |
| IUPAC Name | 1-pentan-3-yloxydecane |
| SMILES | CCCCCCCCCCOC(CC)CC |
| InChI | InChI=1S/C15H32O/c1-4-7-8-9-10-11-12-13-14-16-15(5-2)6-3/h15H,4-14H2,1-3H3 |
| InChIKey | MNWOHBRVOIDISY-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 228.42 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-pentan-3-yloxydecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pentan-3-yloxydecane?
The IUPAC name of 1-pentan-3-yloxydecane (CID 173279604) is 1-pentan-3-yloxydecane.
What is the SMILES notation for 1-pentan-3-yloxydecane?
The canonical SMILES for 1-pentan-3-yloxydecane is CCCCCCCCCCOC(CC)CC.
What is the InChIKey of 1-pentan-3-yloxydecane?
The InChIKey is MNWOHBRVOIDISY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32O/c1-4-7-8-9-10-11-12-13-14-16-15(5-2)6-3/h15H,4-14H2,1-3H3.
What are the key properties of 1-pentan-3-yloxydecane?
1-pentan-3-yloxydecane has a molecular weight of 228.42 g/mol, XLogP of 5.33, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pentan-3-yloxydecane is sourced from PubChem (CID 173279604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).