About 1-(4-octoxyhexoxy)nonane
1-(4-octoxyhexoxy)nonane (PubChem CID 173430678) has the molecular formula C23H48O2
and a molecular weight of 356.64 g/mol. Its IUPAC name is 1-(4-octoxyhexoxy)nonane.
Molecular Properties
| Compound Name | 1-(4-octoxyhexoxy)nonane |
| PubChem CID | 173430678 |
| Molecular Formula | C23H48O2 |
| Molecular Weight | 356.64 g/mol |
| Exact Mass | 356.37 |
| IUPAC Name | 1-(4-octoxyhexoxy)nonane |
| SMILES | CCCCCCCCCOCCCC(CC)OCCCCCCCC |
| InChI | InChI=1S/C23H48O2/c1-4-7-9-11-13-14-16-20-24-21-18-19-23(6-3)25-22-17-15-12-10-8-5-2/h23H,4-22H2,1-3H3 |
| InChIKey | FKHZBVUIMVUXDZ-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.64 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-octoxyhexoxy)nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-octoxyhexoxy)nonane?
The IUPAC name of 1-(4-octoxyhexoxy)nonane (CID 173430678) is 1-(4-octoxyhexoxy)nonane.
What is the SMILES notation for 1-(4-octoxyhexoxy)nonane?
The canonical SMILES for 1-(4-octoxyhexoxy)nonane is CCCCCCCCCOCCCC(CC)OCCCCCCCC.
What is the InChIKey of 1-(4-octoxyhexoxy)nonane?
The InChIKey is FKHZBVUIMVUXDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H48O2/c1-4-7-9-11-13-14-16-20-24-21-18-19-23(6-3)25-22-17-15-12-10-8-5-2/h23H,4-22H2,1-3H3.
What are the key properties of 1-(4-octoxyhexoxy)nonane?
1-(4-octoxyhexoxy)nonane has a molecular weight of 356.64 g/mol, XLogP of 7.69, 21 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-octoxyhexoxy)nonane is sourced from PubChem (CID 173430678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).