C16H30F6O2Sn — CID 87371522
dibutoxy-bis(2,3,4-trifluorobutyl)stannane (PubChem CID 87371522) has the molecular formula C16H30F6O2Sn and a molecular weight of 487.11 g/mol. Its IUPAC name is dibutoxy-bis(2,3,4-trifluorobutyl)stannane.
| Compound Name | dibutoxy-bis(2,3,4-trifluorobutyl)stannane |
|---|---|
| PubChem CID | 87371522 |
| Molecular Formula | C16H30F6O2Sn |
| Molecular Weight | 487.11 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | dibutoxy-bis(2,3,4-trifluorobutyl)stannane |
| SMILES | CCCCO[Sn](CC(F)C(F)CF)(CC(F)C(F)CF)OCCCC |
| InChI | InChI=1S/2C4H6F3.2C4H9O.Sn/c2*1-3(6)4(7)2-5;2*1-2-3-4-5;/h2*3-4H,1-2H2;2*2-4H2,1H3;/q;;2*-1;+2 |
| InChIKey | XYJFBYUTGKAGHO-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.11 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|