C13H25F3O2Sn — CID 87370940
nonoxy-oxo-(2,3,4-trifluorobutyl)tin (PubChem CID 87370940) has the molecular formula C13H25F3O2Sn and a molecular weight of 389.05 g/mol. Its IUPAC name is nonoxy-oxo-(2,3,4-trifluorobutyl)tin.
| Compound Name | nonoxy-oxo-(2,3,4-trifluorobutyl)tin |
|---|---|
| PubChem CID | 87370940 |
| Molecular Formula | C13H25F3O2Sn |
| Molecular Weight | 389.05 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | nonoxy-oxo-(2,3,4-trifluorobutyl)tin |
| SMILES | CCCCCCCCCO[Sn](=O)CC(F)C(F)CF |
| InChI | InChI=1S/C9H19O.C4H6F3.O.Sn/c1-2-3-4-5-6-7-8-9-10;1-3(6)4(7)2-5;;/h2-9H2,1H3;3-4H,1-2H2;;/q-1;;;+1 |
| InChIKey | YPSIPHGFFVKXKH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.05 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|