C14H23F7O2Sn — CID 87371739
decoxy-(1,2,2,3,3,4,4-heptafluorobutyl)-oxotin (PubChem CID 87371739) has the molecular formula C14H23F7O2Sn and a molecular weight of 475.03 g/mol. Its IUPAC name is decoxy-(1,2,2,3,3,4,4-heptafluorobutyl)-oxotin.
| Compound Name | decoxy-(1,2,2,3,3,4,4-heptafluorobutyl)-oxotin |
|---|---|
| PubChem CID | 87371739 |
| Molecular Formula | C14H23F7O2Sn |
| Molecular Weight | 475.03 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | decoxy-(1,2,2,3,3,4,4-heptafluorobutyl)-oxotin |
| SMILES | CCCCCCCCCCO[Sn](=O)C(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C10H21O.C4H2F7.O.Sn/c1-2-3-4-5-6-7-8-9-10-11;5-1-3(8,9)4(10,11)2(6)7;;/h2-10H2,1H3;1-2H;;/q-1;;;+1 |
| InChIKey | SYMFEMYDYLBAPC-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.03 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|