C15H31F3O3Si — CID 87364687
tributoxy(2,3,3-trifluoropropyl)silane (PubChem CID 87364687) has the molecular formula C15H31F3O3Si and a molecular weight of 344.49 g/mol. Its IUPAC name is tributoxy(2,3,3-trifluoropropyl)silane.
| Compound Name | tributoxy(2,3,3-trifluoropropyl)silane |
|---|---|
| PubChem CID | 87364687 |
| Molecular Formula | C15H31F3O3Si |
| Molecular Weight | 344.49 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | tributoxy(2,3,3-trifluoropropyl)silane |
| SMILES | CCCCO[Si](CC(F)C(F)F)(OCCCC)OCCCC |
| InChI | InChI=1S/C15H31F3O3Si/c1-4-7-10-19-22(20-11-8-5-2,21-12-9-6-3)13-14(16)15(17)18/h14-15H,4-13H2,1-3H3 |
| InChIKey | PWNRRTRZPJMKKW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|