C10H18F6O2Si — CID 87383114
diethoxy-bis(2,3,3-trifluoropropyl)silane (PubChem CID 87383114) has the molecular formula C10H18F6O2Si and a molecular weight of 312.33 g/mol. Its IUPAC name is diethoxy-bis(2,3,3-trifluoropropyl)silane.
| Compound Name | diethoxy-bis(2,3,3-trifluoropropyl)silane |
|---|---|
| PubChem CID | 87383114 |
| Molecular Formula | C10H18F6O2Si |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | diethoxy-bis(2,3,3-trifluoropropyl)silane |
| SMILES | CCO[Si](CC(F)C(F)F)(CC(F)C(F)F)OCC |
| InChI | InChI=1S/C10H18F6O2Si/c1-3-17-19(18-4-2,5-7(11)9(13)14)6-8(12)10(15)16/h7-10H,3-6H2,1-2H3 |
| InChIKey | VLGVWPDSKDCNIK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|