About ethyl(tripropoxy)silane;tributoxy(ethyl)silane
ethyl(tripropoxy)silane;tributoxy(ethyl)silane (PubChem CID 160706387) has the molecular formula C25H58O6Si2
and a molecular weight of 510.91 g/mol. Its IUPAC name is ethyl(tripropoxy)silane;tributoxy(ethyl)silane.
Molecular Properties
| Compound Name | ethyl(tripropoxy)silane;tributoxy(ethyl)silane |
| PubChem CID | 160706387 |
| Molecular Formula | C25H58O6Si2 |
| Molecular Weight | 510.91 g/mol |
| Exact Mass | 510.38 |
| IUPAC Name | ethyl(tripropoxy)silane;tributoxy(ethyl)silane |
| SMILES | CCCCO[Si](CC)(OCCCC)OCCCC.CCCO[Si](CC)(OCCC)OCCC |
| InChI | InChI=1S/C14H32O3Si.C11H26O3Si/c1-5-9-12-15-18(8-4,16-13-10-6-2)17-14-11-7-3;1-5-9-12-15(8-4,13-10-6-2)14-11-7-3/h5-14H2,1-4H3;5-11H2,1-4H3 |
| InChIKey | RRGZRNMCWRFHFS-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 510.91 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl(tripropoxy)silane;tributoxy(ethyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl(tripropoxy)silane;tributoxy(ethyl)silane?
The IUPAC name of ethyl(tripropoxy)silane;tributoxy(ethyl)silane (CID 160706387) is ethyl(tripropoxy)silane;tributoxy(ethyl)silane.
What is the SMILES notation for ethyl(tripropoxy)silane;tributoxy(ethyl)silane?
The canonical SMILES for ethyl(tripropoxy)silane;tributoxy(ethyl)silane is CCCCO[Si](CC)(OCCCC)OCCCC.CCCO[Si](CC)(OCCC)OCCC.
What is the InChIKey of ethyl(tripropoxy)silane;tributoxy(ethyl)silane?
The InChIKey is RRGZRNMCWRFHFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H32O3Si.C11H26O3Si/c1-5-9-12-15-18(8-4,16-13-10-6-2)17-14-11-7-3;1-5-9-12-15(8-4,13-10-6-2)14-11-7-3/h5-14H2,1-4H3;5-11H2,1-4H3.
What are the key properties of ethyl(tripropoxy)silane;tributoxy(ethyl)silane?
ethyl(tripropoxy)silane;tributoxy(ethyl)silane has a molecular weight of 510.91 g/mol, XLogP of 7.62, 23 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl(tripropoxy)silane;tributoxy(ethyl)silane is sourced from PubChem (CID 160706387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).