C10H18F6O2Sn — CID 87371114
dimethoxy-bis(2,3,4-trifluorobutyl)stannane (PubChem CID 87371114) has the molecular formula C10H18F6O2Sn and a molecular weight of 402.95 g/mol. Its IUPAC name is dimethoxy-bis(2,3,4-trifluorobutyl)stannane.
| Compound Name | dimethoxy-bis(2,3,4-trifluorobutyl)stannane |
|---|---|
| PubChem CID | 87371114 |
| Molecular Formula | C10H18F6O2Sn |
| Molecular Weight | 402.95 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | dimethoxy-bis(2,3,4-trifluorobutyl)stannane |
| SMILES | CO[Sn](CC(F)C(F)CF)(CC(F)C(F)CF)OC |
| InChI | InChI=1S/2C4H6F3.2CH3O.Sn/c2*1-3(6)4(7)2-5;2*1-2;/h2*3-4H,1-2H2;2*1H3;/q;;2*-1;+2 |
| InChIKey | XBCDJZKRZODDJB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.95 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |