About dimethoxy-bis(2,3,4-trifluorobutyl)stannane
dimethoxy-bis(2,3,4-trifluorobutyl)stannane (PubChem CID 87371114) has the molecular formula C10H18F6O2Sn
and a molecular weight of 402.95 g/mol. Its IUPAC name is dimethoxy-bis(2,3,4-trifluorobutyl)stannane.
Molecular Properties
| Compound Name | dimethoxy-bis(2,3,4-trifluorobutyl)stannane |
| PubChem CID | 87371114 |
| Molecular Formula | C10H18F6O2Sn |
| Molecular Weight | 402.95 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | dimethoxy-bis(2,3,4-trifluorobutyl)stannane |
| SMILES | CO[Sn](CC(F)C(F)CF)(CC(F)C(F)CF)OC |
| InChI | InChI=1S/2C4H6F3.2CH3O.Sn/c2*1-3(6)4(7)2-5;2*1-2;/h2*3-4H,1-2H2;2*1H3;/q;;2*-1;+2 |
| InChIKey | XBCDJZKRZODDJB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.95 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze dimethoxy-bis(2,3,4-trifluorobutyl)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxy-bis(2,3,4-trifluorobutyl)stannane?
The IUPAC name of dimethoxy-bis(2,3,4-trifluorobutyl)stannane (CID 87371114) is dimethoxy-bis(2,3,4-trifluorobutyl)stannane.
What is the SMILES notation for dimethoxy-bis(2,3,4-trifluorobutyl)stannane?
The canonical SMILES for dimethoxy-bis(2,3,4-trifluorobutyl)stannane is CO[Sn](CC(F)C(F)CF)(CC(F)C(F)CF)OC.
What is the InChIKey of dimethoxy-bis(2,3,4-trifluorobutyl)stannane?
The InChIKey is XBCDJZKRZODDJB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H6F3.2CH3O.Sn/c2*1-3(6)4(7)2-5;2*1-2;/h2*3-4H,1-2H2;2*1H3;/q;;2*-1;+2.
What are the key properties of dimethoxy-bis(2,3,4-trifluorobutyl)stannane?
dimethoxy-bis(2,3,4-trifluorobutyl)stannane has a molecular weight of 402.95 g/mol, XLogP of 3.01, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxy-bis(2,3,4-trifluorobutyl)stannane is sourced from PubChem (CID 87371114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).