About 1-fluoro-1-methoxyethane;1-fluoropropane
1-fluoro-1-methoxyethane;1-fluoropropane (PubChem CID 90700579) has the molecular formula C6H14F2O
and a molecular weight of 140.17 g/mol. Its IUPAC name is 1-fluoro-1-methoxyethane;1-fluoropropane.
Molecular Properties
| Compound Name | 1-fluoro-1-methoxyethane;1-fluoropropane |
| PubChem CID | 90700579 |
| Molecular Formula | C6H14F2O |
| Molecular Weight | 140.17 g/mol |
| Exact Mass | 140.10 |
| IUPAC Name | 1-fluoro-1-methoxyethane;1-fluoropropane |
| SMILES | CCCF.COC(C)F |
| InChI | InChI=1S/C3H7FO.C3H7F/c1-3(4)5-2;1-2-3-4/h3H,1-2H3;2-3H2,1H3 |
| InChIKey | BYDIXKDUVAAPHM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.17 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-fluoro-1-methoxyethane;1-fluoropropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-1-methoxyethane;1-fluoropropane?
The IUPAC name of 1-fluoro-1-methoxyethane;1-fluoropropane (CID 90700579) is 1-fluoro-1-methoxyethane;1-fluoropropane.
What is the SMILES notation for 1-fluoro-1-methoxyethane;1-fluoropropane?
The canonical SMILES for 1-fluoro-1-methoxyethane;1-fluoropropane is CCCF.COC(C)F.
What is the InChIKey of 1-fluoro-1-methoxyethane;1-fluoropropane?
The InChIKey is BYDIXKDUVAAPHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7FO.C3H7F/c1-3(4)5-2;1-2-3-4/h3H,1-2H3;2-3H2,1H3.
What are the key properties of 1-fluoro-1-methoxyethane;1-fluoropropane?
1-fluoro-1-methoxyethane;1-fluoropropane has a molecular weight of 140.17 g/mol, XLogP of 2.31, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-1-methoxyethane;1-fluoropropane is sourced from PubChem (CID 90700579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).