About 1-fluoro-3,4-dimethoxypentadecane
1-fluoro-3,4-dimethoxypentadecane (PubChem CID 174316150) has the molecular formula C17H35FO2
and a molecular weight of 290.46 g/mol. Its IUPAC name is 1-fluoro-3,4-dimethoxypentadecane.
Molecular Properties
| Compound Name | 1-fluoro-3,4-dimethoxypentadecane |
| PubChem CID | 174316150 |
| Molecular Formula | C17H35FO2 |
| Molecular Weight | 290.46 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | 1-fluoro-3,4-dimethoxypentadecane |
| SMILES | CCCCCCCCCCCC(OC)C(CCF)OC |
| InChI | InChI=1S/C17H35FO2/c1-4-5-6-7-8-9-10-11-12-13-16(19-2)17(20-3)14-15-18/h16-17H,4-15H2,1-3H3 |
| InChIKey | PWWOHIGZAMYZBC-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.46 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoro-3,4-dimethoxypentadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-3,4-dimethoxypentadecane?
The IUPAC name of 1-fluoro-3,4-dimethoxypentadecane (CID 174316150) is 1-fluoro-3,4-dimethoxypentadecane.
What is the SMILES notation for 1-fluoro-3,4-dimethoxypentadecane?
The canonical SMILES for 1-fluoro-3,4-dimethoxypentadecane is CCCCCCCCCCCC(OC)C(CCF)OC.
What is the InChIKey of 1-fluoro-3,4-dimethoxypentadecane?
The InChIKey is PWWOHIGZAMYZBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35FO2/c1-4-5-6-7-8-9-10-11-12-13-16(19-2)17(20-3)14-15-18/h16-17H,4-15H2,1-3H3.
What are the key properties of 1-fluoro-3,4-dimethoxypentadecane?
1-fluoro-3,4-dimethoxypentadecane has a molecular weight of 290.46 g/mol, XLogP of 5.30, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-3,4-dimethoxypentadecane is sourced from PubChem (CID 174316150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).