About 2-ethoxy-3-methoxynonane
2-ethoxy-3-methoxynonane (PubChem CID 175129428) has the molecular formula C12H26O2
and a molecular weight of 202.34 g/mol. Its IUPAC name is 2-ethoxy-3-methoxynonane.
Molecular Properties
| Compound Name | 2-ethoxy-3-methoxynonane |
| PubChem CID | 175129428 |
| Molecular Formula | C12H26O2 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.19 |
| IUPAC Name | 2-ethoxy-3-methoxynonane |
| SMILES | CCCCCCC(OC)C(C)OCC |
| InChI | InChI=1S/C12H26O2/c1-5-7-8-9-10-12(13-4)11(3)14-6-2/h11-12H,5-10H2,1-4H3 |
| InChIKey | QPJFOOIQFSPRSW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxy-3-methoxynonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-3-methoxynonane?
The IUPAC name of 2-ethoxy-3-methoxynonane (CID 175129428) is 2-ethoxy-3-methoxynonane.
What is the SMILES notation for 2-ethoxy-3-methoxynonane?
The canonical SMILES for 2-ethoxy-3-methoxynonane is CCCCCCC(OC)C(C)OCC.
What is the InChIKey of 2-ethoxy-3-methoxynonane?
The InChIKey is QPJFOOIQFSPRSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O2/c1-5-7-8-9-10-12(13-4)11(3)14-6-2/h11-12H,5-10H2,1-4H3.
What are the key properties of 2-ethoxy-3-methoxynonane?
2-ethoxy-3-methoxynonane has a molecular weight of 202.34 g/mol, XLogP of 3.40, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-3-methoxynonane is sourced from PubChem (CID 175129428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).