C22H44O — CID 102492829
(9R,10R)-10-ethenyl-9-methoxynonadecane (PubChem CID 102492829) has the molecular formula C22H44O and a molecular weight of 324.59 g/mol. Its IUPAC name is (9R,10R)-10-ethenyl-9-methoxynonadecane.
| Compound Name | (9R,10R)-10-ethenyl-9-methoxynonadecane |
|---|---|
| PubChem CID | 102492829 |
| Molecular Formula | C22H44O |
| Molecular Weight | 324.59 g/mol |
| Exact Mass | 324.34 |
| IUPAC Name | (9R,10R)-10-ethenyl-9-methoxynonadecane |
| SMILES | C=C[C@@H](CCCCCCCCC)[C@@H](CCCCCCCC)OC |
| InChI | InChI=1S/C22H44O/c1-5-8-10-12-14-15-17-19-21(7-3)22(23-4)20-18-16-13-11-9-6-2/h7,21-22H,3,5-6,8-20H2,1-2,4H3/t21-,22+/m0/s1 |
| InChIKey | FHWJXPKJQJWWPU-FCHUYYIVSA-N |
| XLogP | 7.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.59 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|