C14H27IO — CID 102090844
(4R,5S)-5-iodo-4-methoxytridec-1-ene (PubChem CID 102090844) has the molecular formula C14H27IO and a molecular weight of 338.27 g/mol. Its IUPAC name is (4R,5S)-5-iodo-4-methoxytridec-1-ene.
| Compound Name | (4R,5S)-5-iodo-4-methoxytridec-1-ene |
|---|---|
| PubChem CID | 102090844 |
| Molecular Formula | C14H27IO |
| Molecular Weight | 338.27 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | (4R,5S)-5-iodo-4-methoxytridec-1-ene |
| SMILES | C=CC[C@@H](OC)[C@@H](I)CCCCCCCC |
| InChI | InChI=1S/C14H27IO/c1-4-6-7-8-9-10-12-13(15)14(16-3)11-5-2/h5,13-14H,2,4,6-12H2,1,3H3/t13-,14+/m0/s1 |
| InChIKey | PBTNCWLXCCQACM-UONOGXRCSA-N |
| XLogP | 5.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.27 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|