C11H22O — CID 57218264
(4S,5S)-4-methoxy-5-methylnon-1-ene (PubChem CID 57218264) has the molecular formula C11H22O and a molecular weight of 170.30 g/mol. Its IUPAC name is (4S,5S)-4-methoxy-5-methylnon-1-ene.
| Compound Name | (4S,5S)-4-methoxy-5-methylnon-1-ene |
|---|---|
| PubChem CID | 57218264 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | (4S,5S)-4-methoxy-5-methylnon-1-ene |
| SMILES | C=CC[C@H](OC)[C@@H](C)CCCC |
| InChI | InChI=1S/C11H22O/c1-5-7-9-10(3)11(12-4)8-6-2/h6,10-11H,2,5,7-9H2,1,3-4H3/t10-,11-/m0/s1 |
| InChIKey | KELZEBVDUDNZLC-QWRGUYRKSA-N |
| XLogP | 3.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|