About 4-fluoropentadec-1-ene
4-fluoropentadec-1-ene (PubChem CID 143980948) has the molecular formula C15H29F
and a molecular weight of 228.39 g/mol. Its IUPAC name is 4-fluoropentadec-1-ene.
Molecular Properties
| Compound Name | 4-fluoropentadec-1-ene |
| PubChem CID | 143980948 |
| Molecular Formula | C15H29F |
| Molecular Weight | 228.39 g/mol |
| Exact Mass | 228.23 |
| IUPAC Name | 4-fluoropentadec-1-ene |
| SMILES | C=CCC(F)CCCCCCCCCCC |
| InChI | InChI=1S/C15H29F/c1-3-5-6-7-8-9-10-11-12-14-15(16)13-4-2/h4,15H,2-3,5-14H2,1H3 |
| InChIKey | HIPRVKSZOWPDAN-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 228.39 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoropentadec-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoropentadec-1-ene?
The IUPAC name of 4-fluoropentadec-1-ene (CID 143980948) is 4-fluoropentadec-1-ene.
What is the SMILES notation for 4-fluoropentadec-1-ene?
The canonical SMILES for 4-fluoropentadec-1-ene is C=CCC(F)CCCCCCCCCCC.
What is the InChIKey of 4-fluoropentadec-1-ene?
The InChIKey is HIPRVKSZOWPDAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29F/c1-3-5-6-7-8-9-10-11-12-14-15(16)13-4-2/h4,15H,2-3,5-14H2,1H3.
What are the key properties of 4-fluoropentadec-1-ene?
4-fluoropentadec-1-ene has a molecular weight of 228.39 g/mol, XLogP of 5.82, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoropentadec-1-ene is sourced from PubChem (CID 143980948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).